Back to Blog

    Hard MCAT Thermodynamics Practice Questions

    May 17, 202612 min read66 views
    Hard MCAT Thermodynamics Practice Questions

    Hard MCAT Thermodynamics Practice Questions

    Mastering thermodynamics is essential for success on the MCAT, as it governs the energy changes and spontaneity of every biological and chemical process in the human body. These Hard MCAT Thermodynamics Practice Questions are designed to challenge your understanding of enthalpy, entropy, Gibbs free energy, and the laws of thermodynamics in complex scenarios. By working through these problems, you will sharpen your ability to apply mathematical formulas and conceptual reasoning to the high-stakes environment of the Medical College Admission Test.

    Concept Explanation

    Thermodynamics is the study of energy, heat, work, and the spontaneity of chemical and physical processes within a defined system and its surroundings. At the core of MCAT thermodynamics are the three laws: the First Law (conservation of energy), the Second Law (entropy of the universe always increases), and the Third Law (entropy of a perfect crystal at absolute zero is zero). To solve high-level problems, students must integrate the concepts of state functions—properties that depend only on the current state of the system, such as enthalpy (HH), entropy (SS), and Gibbs free energy (GG).

    Key relationships include the Gibbs free energy equation, which determines reaction spontaneity:

    ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S

    When ΔG<0\Delta G < 0, the reaction is exergonic and spontaneous; when ΔG>0\Delta G > 0, it is endergonic and non-spontaneous. Furthermore, the relationship between the standard free energy change and the equilibrium constant (KK_{ \neq}) is a frequent target for Hard MCAT Equilibrium Practice Questions. This relationship is expressed as:

    ΔG=RTlnK\Delta G^\circ = -RT \ln K_{ \neq}

    Understanding the distinction between standard conditions (1 atm, 298 K, 1 M concentrations) and non-standard conditions is vital. For non-standard states, we use the reaction quotient (QQ):

    ΔG=ΔG+RTlnQ\Delta G = \Delta G^\circ + RT \ln Q

    According to Wikipedia's Laws of Thermodynamics, these principles apply universally, from the expansion of gases in a piston to the folding of proteins in a cell. For more foundational chemistry practice, you may also find Hard MCAT General Chemistry Practice Questions helpful.

    Solved Examples

    1. Calculating Gibbs Free Energy: A reaction has an enthalpy change (ΔH\Delta H) of 120 kJ/mol-120 \text{ kJ/mol} and an entropy change (ΔS\Delta S) of 400 J/molK-400 \text{ J/mol}\cdot \text{K}. At what temperature does the reaction switch from spontaneous to non-spontaneous?
      1. Identify the condition for the transition: The transition occurs when ΔG=0\Delta G = 0.
      2. Set up the equation: 0=ΔHTΔS0 = \Delta H - T\Delta S, which rearranges to T=ΔHΔST = \frac{\Delta H}{\Delta S}.
      3. Convert units: ΔH=120,000 J/mol\Delta H = -120,000 \text{ J/mol}.
      4. Solve for TT: T=120,000400=300 KT = \frac{-120,000}{-400} = 300 \text{ K}.
      5. Conclusion: The reaction is spontaneous below 300 K (where the exothermic term dominates) and non-spontaneous above 300 K (where the entropy loss dominates).
    2. Relating ΔG\Delta G^\circ to KK_{ \neq}: If a reaction at 298 K has a standard free energy change (ΔG\Delta G^\circ) of 5.7 kJ/mol-5.7 \text{ kJ/mol}, what is the equilibrium constant KK_{ \neq}? (Use R=8.314 J/molKR = 8.314 \text{ J/mol}\cdot \text{K}).
      1. Use the formula: ΔG=RTlnK\Delta G^\circ = -RT \ln K_{ \neq}.
      2. Convert ΔG\Delta G^\circ to Joules: 5,700 J/mol-5,700 \text{ J/mol}.
      3. Isolate lnK\ln K_{ \neq}: lnK=5,700(8.314×298)5,7002,4772.3\ln K_{ \neq} = \frac{-5,700}{-(8.314 \times 298)} \approx \frac{-5,700}{-2,477} \approx 2.3.
      4. Solve for KK_{ \neq}: K=e2.310K_{ \neq} = e^{2.3} \approx 10.
      5. Conclusion: Since ΔG\Delta G^\circ is negative, K>1K_{ \neq} > 1, favoring products.
    3. Hess’s Law Application: Find ΔHrxn\Delta H_{rxn} for A+BCA + B \rightarrow C given: 2AD(ΔH1=100 kJ)2A \rightarrow D \quad (\Delta H_1 = 100 \text{ kJ}) D+2B2C(ΔH2=50 kJ)D + 2B \rightarrow 2C \quad (\Delta H_2 = -50 \text{ kJ})
      1. Manipulate the first equation: Divide by 2 to get A0.5DA \rightarrow 0.5D. ΔH=100/2=50 kJ\Delta H = 100 / 2 = 50 \text{ kJ}.
      2. Manipulate the second equation: Divide by 2 to get 0.5D+BC0.5D + B \rightarrow C. ΔH=50/2=25 kJ\Delta H = -50 / 2 = -25 \text{ kJ}.
      3. Sum the reactions: A+0.5D+B0.5D+CA + 0.5D + B \rightarrow 0.5D + C. The 0.5D0.5D cancels out.
      4. Sum the enthalpies: 50 kJ+(25 kJ)=25 kJ50 \text{ kJ} + (-25 \text{ kJ}) = 25 \text{ kJ}.

    Practice Questions

    1. A specific protein folding process is found to be spontaneous at 298 K despite having a positive change in enthalpy (ΔH>0\Delta H > 0). Which of the following must be true regarding the entropy change (ΔS\Delta S) of the system?

    2. Consider the combustion of glucose: C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l)C_6H_{12}O_6(s) + 6O_2(g) \rightarrow 6CO_2(g) + 6H_2O(l). If the standard enthalpy of combustion is 2800 kJ/mol-2800 \text{ kJ/mol}, how much heat is released when 45 grams of glucose (Molar Mass = 180 g/mol) is burned?

    3. A reaction has ΔG=+15 kJ/mol\Delta G^\circ = +15 \text{ kJ/mol}. If the reaction is coupled with the hydrolysis of ATP (ΔG=30 kJ/mol\Delta G^\circ = -30 \text{ kJ/mol}), what is the overall equilibrium constant KK_{ \neq} for the coupled reaction at 300 K? (Use R=8.3 J/molKR = 8.3 \text{ J/mol}\cdot \text{K}).

    Track your MCAT progress intelligently.

    Use Bevinzey’s analytics and AI-powered feedback to identify weaknesses and improve faster.

    See My Progress

    4. For a gaseous reaction, ΔG\Delta G is measured at 350 K. If the partial pressures of reactants are increased by a factor of 10 while products remain constant, how does ΔG\Delta G change? (Assume ideal gas behavior).

    5. Which of the following conditions ensures that a reaction is spontaneous at all temperatures?

    6. According to the Khan Academy guide on Free Energy, the hydrophobic effect is a major driver of protein folding. In terms of thermodynamics, why is the sequestration of nonpolar sidechains into the protein core entropically favorable for the solvent?

    7. A heat engine operates between a hot reservoir at 600 K and a cold reservoir at 300 K. What is the maximum theoretical efficiency of this engine?

    8. Given the bond dissociation energies: CH=413 kJ/molC-H = 413 \text{ kJ/mol}, ClCl=242 kJ/molCl-Cl = 242 \text{ kJ/mol}, CCl=339 kJ/molC-Cl = 339 \text{ kJ/mol}, and HCl=431 kJ/molH-Cl = 431 \text{ kJ/mol}. Calculate the enthalpy change for the chlorination of methane: CH4+Cl2CH3Cl+HClCH_4 + Cl_2 \rightarrow CH_3Cl + HCl.

    9. A rigid container holds an ideal gas at 300 K. If the internal energy of the gas increases by 150 J while 50 J of work is done on the gas, how much heat was exchanged with the surroundings?

    10. In a bomb calorimeter, the combustion of a 1.0 g sample of a compound increases the temperature of 1000 g of water by 5°C. If the specific heat of water is 4.18 J/gC4.18 \text{ J/g}\cdot \text{C}, what is the heat of combustion per gram?

    Answers & Explanations

    1. Answer: ΔS\Delta S must be positive and TΔS>ΔHT\Delta S > \Delta H. For a reaction to be spontaneous (ΔG<0\Delta G < 0) when ΔH\Delta H is positive (endothermic), the TΔS-T\Delta S term must be sufficiently negative to outweigh the enthalpy. This requires a positive ΔS\Delta S and a high enough temperature.
    2. Answer: 700 kJ. First, find the moles of glucose: 45 g/180 g/mol=0.25 mol45 \text{ g} / 180 \text{ g/mol} = 0.25 \text{ mol}. Then, multiply moles by the molar enthalpy: 0.25 mol×2800 kJ/mol=700 kJ0.25 \text{ mol} \times 2800 \text{ kJ/mol} = 700 \text{ kJ}.
    3. Answer: K400K_{ \neq} \approx 400. The net ΔG=15+(30)=15 kJ/mol\Delta G^\circ = 15 + (-30) = -15 \text{ kJ/mol}. Using ΔG=RTlnK\Delta G^\circ = -RT \ln K_{ \neq}: 15,000=(8.3×300)lnK-15,000 = -(8.3 \times 300) \ln K_{ \neq}. 15,000/2,490615,000 / 2,490 \approx 6. K=e6403K_{ \neq} = e^6 \approx 403.
    4. Answer: ΔG\Delta G decreases (becomes more negative). Using ΔG=ΔG+RTlnQ\Delta G = \Delta G^\circ + RT \ln Q, increasing reactant concentration decreases the value of QQ. Since ln(Q)\ln(Q) becomes more negative as QQ decreases, ΔG\Delta G decreases, making the reaction more spontaneous.
    5. Answer: ΔH<0\Delta H < 0 and ΔS>0\Delta S > 0. When a reaction is exothermic and increases disorder, both terms in ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S contribute to a negative ΔG\Delta G regardless of the value of TT.
    6. Answer: It releases water molecules from highly ordered "clathrate" cages. When nonpolar groups are exposed, water must form rigid structures around them. When they aggregate, water is released into the bulk solvent, greatly increasing the entropy of the universe.
    7. Answer: 50%. Carnot efficiency is calculated as η=1(Tcold/Thot)\eta = 1 - (T_{cold} / T_{hot}). Here, η=1(300/600)=0.5\eta = 1 - (300/600) = 0.5 or 50%.
    8. Answer: -115 kJ/mol. ΔH=Bonds BrokenBonds Formed\Delta H = \text{Bonds Broken} - \text{Bonds Formed}. Broken: 1(CH)+1(ClCl)=413+242=6551(C-H) + 1(Cl-Cl) = 413 + 242 = 655. Formed: 1(CCl)+1(HCl)=339+431=7701(C-Cl) + 1(H-Cl) = 339 + 431 = 770. ΔH=655770=115 kJ/mol\Delta H = 655 - 770 = -115 \text{ kJ/mol}.
    9. Answer: 100 J added to the system. According to the First Law, ΔU=Q+W\Delta U = Q + W (using the convention where WW is work done on the system). 150=Q+50150 = Q + 50, so Q=100 JQ = 100 \text{ J}.
    10. Answer: 20.9 kJ/g. q=mcΔT=(1000 g)(4.18 J/gC)(5C)=20,900 J=20.9 kJq = mc\Delta T = (1000 \text{ g})(4.18 \text{ J/g}\cdot \text{C})(5 \text{C}) = 20,900 \text{ J} = 20.9 \text{ kJ}. Since the sample was 1.0 g, the heat per gram is 20.9 kJ/g.
    Interactive quizQuestion 1 of 5

    1. Which of the following is a state function?

    Pick an answer to check

    Frequently Asked Questions

    What is the difference between ΔG\Delta G and ΔG\Delta G^\circ?

    ΔG\Delta G^\circ represents the free energy change under standard conditions (1 M, 1 atm, 298 K), while ΔG\Delta G represents the free energy change at any specific, non-standard concentration or pressure. ΔG\Delta G determines the actual spontaneity of a reaction in a real-time environment like a human cell.

    Can an endothermic reaction be spontaneous?

    Yes, an endothermic reaction (ΔH>0\Delta H > 0) can be spontaneous if the entropy change (ΔS\Delta S) is positive and the temperature is high enough. In this case, the TΔST\Delta S term outweighs the positive enthalpy, resulting in a negative Gibbs free energy.

    How does the MCAT test the First Law of Thermodynamics?

    The MCAT typically tests the First Law through the equation ΔU=QW\Delta U = Q - W or ΔU=Q+W\Delta U = Q + W, requiring students to track energy transfers between heat and work. It often appears in the context of metabolic processes or ideal gas expansions in the Hard MCAT Thermochemistry Practice Questions section.

    Why is entropy often described as "disorder"?

    Entropy is a measure of the number of microstates available to a system; more microstates correspond to what we macroscopically perceive as disorder. In biological systems, increasing entropy usually involves breaking down large polymers into smaller monomers or releasing solvent molecules from organized cages.

    What is the significance of the Third Law of Thermodynamics?

    The Third Law establishes an absolute reference point for entropy, stating that the entropy of a perfect crystal at 0 K is zero. This allows scientists to calculate absolute entropy values for substances at various temperatures rather than just measuring changes in entropy.

    Track your MCAT progress intelligently.

    Use Bevinzey’s analytics and AI-powered feedback to identify weaknesses and improve faster.

    See My Progress
    MD

    Reviewed by

    Michael Danquah, MS, PhD

    Dr. Michael Danquah is a professor of pharmaceutical sciences and founder of several educational technology platforms focused on improving student learning and performance.

    Enjoyed this article?

    Share it with others who might find it helpful.

    Related Articles

    Keep exploring